About 4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one
4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one (PubChem CID 54721778) has the molecular formula C25H22O3
and a molecular weight of 370.45 g/mol. Its IUPAC name is 4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one.
Molecular Properties
| Compound Name | 4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one |
| PubChem CID | 54721778 |
| Molecular Formula | C25H22O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one |
| SMILES | O=C1OC(c2ccccc2)(c2ccccc2)CC(O)=C1CCc1ccccc1 |
| InChI | InChI=1S/C25H22O3/c26-23-18-25(20-12-6-2-7-13-20,21-14-8-3-9-15-21)28-24(27)22(23)17-16-19-10-4-1-5-11-19/h1-15,26H,16-18H2 |
| InChIKey | PBBBXISZVJJMKO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one?
The IUPAC name of 4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one (CID 54721778) is 4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one.
What is the SMILES notation for 4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one?
The canonical SMILES for 4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one is O=C1OC(c2ccccc2)(c2ccccc2)CC(O)=C1CCc1ccccc1.
What is the InChIKey of 4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one?
The InChIKey is PBBBXISZVJJMKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22O3/c26-23-18-25(20-12-6-2-7-13-20,21-14-8-3-9-15-21)28-24(27)22(23)17-16-19-10-4-1-5-11-19/h1-15,26H,16-18H2.
What are the key properties of 4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one?
4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one has a molecular weight of 370.45 g/mol, XLogP of 5.32, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,2-diphenyl-5-(2-phenylethyl)-3H-pyran-6-one is sourced from PubChem (CID 54721778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).