C26H19NO4 — CID 54722131
(E)-1-(4-hydroxy-2-oxo-1-phenylquinolin-3-yl)-5-phenylpent-4-ene-1,3-dione (PubChem CID 54722131) has the molecular formula C26H19NO4 and a molecular weight of 409.44 g/mol. Its IUPAC name is (E)-1-(4-hydroxy-2-oxo-1-phenylquinolin-3-yl)-5-phenylpent-4-ene-1,3-dione.
| Compound Name | (E)-1-(4-hydroxy-2-oxo-1-phenylquinolin-3-yl)-5-phenylpent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 54722131 |
| Molecular Formula | C26H19NO4 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (E)-1-(4-hydroxy-2-oxo-1-phenylquinolin-3-yl)-5-phenylpent-4-ene-1,3-dione |
| SMILES | O=C(/C=C/c1ccccc1)CC(=O)c1c(O)c2ccccc2n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C26H19NO4/c28-20(16-15-18-9-3-1-4-10-18)17-23(29)24-25(30)21-13-7-8-14-22(21)27(26(24)31)19-11-5-2-6-12-19/h1-16,30H,17H2/b16-15+ |
| InChIKey | AIPIGXGZRHCDOY-FOCLMDBBSA-N |
| XLogP | 4.55 |
| TPSA | 76.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|