C26H16F5NO8 — CID 54722309
(6Z)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[(2,3,4,5,6-pentafluorophenyl)methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 54722309) has the molecular formula C26H16F5NO8 and a molecular weight of 565.40 g/mol. Its IUPAC name is (6Z)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[(2,3,4,5,6-pentafluorophenyl)methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (6Z)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[(2,3,4,5,6-pentafluorophenyl)methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722309 |
| Molecular Formula | C26H16F5NO8 |
| Molecular Weight | 565.40 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | (6Z)-1,5,10,11,12a-pentahydroxy-3,12-dioxo-6-[(2,3,4,5,6-pentafluorophenyl)methylidene]-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)cccc4/C(=C\c4c(F)c(F)c(F)c(F)c4F)C3C(O)C2CC1=O |
| InChI | InChI=1S/C26H16F5NO8/c27-16-8(17(28)19(30)20(31)18(16)29)4-7-6-2-1-3-10(33)12(6)22(36)15-13(7)21(35)9-5-11(34)14(25(32)39)23(37)26(9,40)24(15)38/h1-4,9,13,21,33,35-37,40H,5H2,(H2,32,39)/b7-4+ |
| InChIKey | VEERABAJRYIPJJ-QPJJXVBHSA-N |
| XLogP | 2.09 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|