C26H20FNO8 — CID 54722435
(6Z)-6-[(4-fluorophenyl)methylidene]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide (PubChem CID 54722435) has the molecular formula C26H20FNO8 and a molecular weight of 493.44 g/mol. Its IUPAC name is (6Z)-6-[(4-fluorophenyl)methylidene]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide.
| Compound Name | (6Z)-6-[(4-fluorophenyl)methylidene]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
|---|---|
| PubChem CID | 54722435 |
| Molecular Formula | C26H20FNO8 |
| Molecular Weight | 493.44 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | (6Z)-6-[(4-fluorophenyl)methylidene]-1,5,10,11,12a-pentahydroxy-3,12-dioxo-4,4a,5,5a-tetrahydrotetracene-2-carboxamide |
| SMILES | NC(=O)C1=C(O)C2(O)C(=O)C3=C(O)c4c(O)cccc4/C(=C\c4ccc(F)cc4)C3C(O)C2CC1=O |
| InChI | InChI=1S/C26H20FNO8/c27-11-6-4-10(5-7-11)8-13-12-2-1-3-15(29)17(12)22(32)20-18(13)21(31)14-9-16(30)19(25(28)35)23(33)26(14,36)24(20)34/h1-8,14,18,21,29,31-33,36H,9H2,(H2,28,35)/b13-8+ |
| InChIKey | BXOQDPROSOBMHX-MDWZMJQESA-N |
| XLogP | 1.53 |
| TPSA | 178.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.44 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|