C21H18CaN4O8 — CID 54723144
calcium;bis(2-carboxyphenolate);3,7-dimethylpurine-2,6-dione (PubChem CID 54723144) has the molecular formula C21H18CaN4O8 and a molecular weight of 494.47 g/mol. Its IUPAC name is calcium;bis(2-carboxyphenolate);3,7-dimethylpurine-2,6-dione.
| Compound Name | calcium;bis(2-carboxyphenolate);3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 54723144 |
| Molecular Formula | C21H18CaN4O8 |
| Molecular Weight | 494.47 g/mol |
| Exact Mass | 494.08 |
| IUPAC Name | calcium;bis(2-carboxyphenolate);3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)[nH]c(=O)n2C.O=C(O)c1ccccc1[O-].O=C(O)c1ccccc1[O-].[Ca+2] |
| InChI | InChI=1S/C7H8N4O2.2C7H6O3.Ca/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2;2*8-6-4-2-1-3-5(6)7(9)10;/h3H,1-2H3,(H,9,12,13);2*1-4,8H,(H,9,10);/q;;;+2/p-2 |
| InChIKey | GDDSFMMICZTVCA-UHFFFAOYSA-L |
| XLogP | -0.50 |
| TPSA | 193.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.47 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |