About 2-carboxyphenolate;pyridin-1-ium
2-carboxyphenolate;pyridin-1-ium (PubChem CID 54723183) has the molecular formula C12H11NO3
and a molecular weight of 217.22 g/mol. Its IUPAC name is 2-carboxyphenolate;pyridin-1-ium.
Molecular Properties
| Compound Name | 2-carboxyphenolate;pyridin-1-ium |
| PubChem CID | 54723183 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-carboxyphenolate;pyridin-1-ium |
| SMILES | O=C(O)c1ccccc1[O-].c1cc[nH+]cc1 |
| InChI | InChI=1S/C7H6O3.C5H5N/c8-6-4-2-1-3-5(6)7(9)10;1-2-4-6-5-3-1/h1-4,8H,(H,9,10);1-5H |
| InChIKey | ONSYFGRVJCIZKU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-carboxyphenolate;pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-carboxyphenolate;pyridin-1-ium?
The IUPAC name of 2-carboxyphenolate;pyridin-1-ium (CID 54723183) is 2-carboxyphenolate;pyridin-1-ium.
What is the SMILES notation for 2-carboxyphenolate;pyridin-1-ium?
The canonical SMILES for 2-carboxyphenolate;pyridin-1-ium is O=C(O)c1ccccc1[O-].c1cc[nH+]cc1.
What is the InChIKey of 2-carboxyphenolate;pyridin-1-ium?
The InChIKey is ONSYFGRVJCIZKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O3.C5H5N/c8-6-4-2-1-3-5(6)7(9)10;1-2-4-6-5-3-1/h1-4,8H,(H,9,10);1-5H.
What are the key properties of 2-carboxyphenolate;pyridin-1-ium?
2-carboxyphenolate;pyridin-1-ium has a molecular weight of 217.22 g/mol, XLogP of 0.96, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-carboxyphenolate;pyridin-1-ium is sourced from PubChem (CID 54723183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).