C21H28NaO9+ — CID 54723288
sodium 3-O,6-O-diethyl 1-O,4-O-dimethyl (3aS,6aS)-2-hydroxy-3a,5,6a-trimethyl-1,4-dihydropentalene-1,3,4,6-tetracarboxylate (PubChem CID 54723288) has the molecular formula C21H28NaO9+ and a molecular weight of 447.44 g/mol. Its IUPAC name is sodium 3-O,6-O-diethyl 1-O,4-O-dimethyl (3aS,6aS)-2-hydroxy-3a,5,6a-trimethyl-1,4-dihydropentalene-1,3,4,6-tetracarboxylate.
| Compound Name | sodium 3-O,6-O-diethyl 1-O,4-O-dimethyl (3aS,6aS)-2-hydroxy-3a,5,6a-trimethyl-1,4-dihydropentalene-1,3,4,6-tetracarboxylate |
|---|---|
| PubChem CID | 54723288 |
| Molecular Formula | C21H28NaO9+ |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | sodium 3-O,6-O-diethyl 1-O,4-O-dimethyl (3aS,6aS)-2-hydroxy-3a,5,6a-trimethyl-1,4-dihydropentalene-1,3,4,6-tetracarboxylate |
| SMILES | CCOC(=O)C1=C(C)C(C(=O)OC)[C@]2(C)C(C(=O)OCC)=C(O)C(C(=O)OC)[C@]12C.[Na+] |
| InChI | InChI=1S/C21H28O9.Na/c1-8-29-18(25)12-10(3)11(16(23)27-6)20(4)14(19(26)30-9-2)15(22)13(17(24)28-7)21(12,20)5;/h11,13,22H,8-9H2,1-7H3;/q;+1/t11?,13?,20-,21+;/m1./s1 |
| InChIKey | ILZXXMIXPRWVFG-NHTZUPLHSA-N |
| XLogP | -1.14 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|