About 2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one
2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one (PubChem CID 54723292) has the molecular formula C8H12O5
and a molecular weight of 188.18 g/mol. Its IUPAC name is 2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | 2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one |
| PubChem CID | 54723292 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one |
| SMILES | COC(OC)C1CC(O)=CC(=O)O1 |
| InChI | InChI=1S/C8H12O5/c1-11-8(12-2)6-3-5(9)4-7(10)13-6/h4,6,8-9H,3H2,1-2H3 |
| InChIKey | FRLQDEXZNYGUHT-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one?
The IUPAC name of 2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one (CID 54723292) is 2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one.
What is the SMILES notation for 2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one?
The canonical SMILES for 2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one is COC(OC)C1CC(O)=CC(=O)O1.
What is the InChIKey of 2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one?
The InChIKey is FRLQDEXZNYGUHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O5/c1-11-8(12-2)6-3-5(9)4-7(10)13-6/h4,6,8-9H,3H2,1-2H3.
What are the key properties of 2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one?
2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one has a molecular weight of 188.18 g/mol, XLogP of 0.36, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethoxymethyl)-4-hydroxy-2,3-dihydropyran-6-one is sourced from PubChem (CID 54723292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).