C27H24N2O5S — CID 5472424
(E)-3-[4-[[3-(4-methoxyphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]sulfonyl]phenyl]prop-2-enoic acid (PubChem CID 5472424) has the molecular formula C27H24N2O5S and a molecular weight of 488.57 g/mol. Its IUPAC name is (E)-3-[4-[[3-(4-methoxyphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]sulfonyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[3-(4-methoxyphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]sulfonyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 5472424 |
| Molecular Formula | C27H24N2O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | (E)-3-[4-[[3-(4-methoxyphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazol-2-yl]sulfonyl]phenyl]prop-2-enoic acid |
| SMILES | COc1ccc(C2C3CCc4ccccc4C3=NN2S(=O)(=O)c2ccc(/C=C/C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H24N2O5S/c1-34-21-12-9-20(10-13-21)27-24-16-11-19-4-2-3-5-23(19)26(24)28-29(27)35(32,33)22-14-6-18(7-15-22)8-17-25(30)31/h2-10,12-15,17,24,27H,11,16H2,1H3,(H,30,31)/b17-8+ |
| InChIKey | PRPUBBKCAZURSJ-CAOOACKPSA-N |
| XLogP | 4.51 |
| TPSA | 96.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|