C21H14O11 — CID 54725374
6,7-dihydroxy-2-methoxy-3-(4,7,8-trihydroxy-2-oxochromen-3-yl)-2,3-dihydrofuro[3,2-c]chromen-4-one (PubChem CID 54725374) has the molecular formula C21H14O11 and a molecular weight of 442.33 g/mol. Its IUPAC name is 6,7-dihydroxy-2-methoxy-3-(4,7,8-trihydroxy-2-oxochromen-3-yl)-2,3-dihydrofuro[3,2-c]chromen-4-one.
| Compound Name | 6,7-dihydroxy-2-methoxy-3-(4,7,8-trihydroxy-2-oxochromen-3-yl)-2,3-dihydrofuro[3,2-c]chromen-4-one |
|---|---|
| PubChem CID | 54725374 |
| Molecular Formula | C21H14O11 |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 442.05 |
| IUPAC Name | 6,7-dihydroxy-2-methoxy-3-(4,7,8-trihydroxy-2-oxochromen-3-yl)-2,3-dihydrofuro[3,2-c]chromen-4-one |
| SMILES | COC1Oc2c(c(=O)oc3c(O)c(O)ccc23)C1c1c(O)c2ccc(O)c(O)c2oc1=O |
| InChI | InChI=1S/C21H14O11/c1-29-21-10(11-13(24)6-2-4-8(22)14(25)17(6)30-19(11)27)12-16(32-21)7-3-5-9(23)15(26)18(7)31-20(12)28/h2-5,10,21-26H,1H3 |
| InChIKey | PSBMNYINGFEYOH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 180.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|