C15H12FN5O3 — CID 54725389
6-azido-2-[(4-fluorophenyl)methyl]-9-hydroxy-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione (PubChem CID 54725389) has the molecular formula C15H12FN5O3 and a molecular weight of 329.29 g/mol. Its IUPAC name is 6-azido-2-[(4-fluorophenyl)methyl]-9-hydroxy-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione.
| Compound Name | 6-azido-2-[(4-fluorophenyl)methyl]-9-hydroxy-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
|---|---|
| PubChem CID | 54725389 |
| Molecular Formula | C15H12FN5O3 |
| Molecular Weight | 329.29 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 6-azido-2-[(4-fluorophenyl)methyl]-9-hydroxy-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
| SMILES | [N-]=[N+]=Nc1cc(=O)c(O)c2n1CCN(Cc1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C15H12FN5O3/c16-10-3-1-9(2-4-10)8-20-5-6-21-12(18-19-17)7-11(22)14(23)13(21)15(20)24/h1-4,7,23H,5-6,8H2 |
| InChIKey | GHQPVXSPTJJYEO-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 111.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.29 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|