C33H29N5O2S — CID 54725508
N-benzyl-2-cyano-4-[[4-(2,4-dimethylphenyl)-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enamide (PubChem CID 54725508) has the molecular formula C33H29N5O2S and a molecular weight of 559.70 g/mol. Its IUPAC name is N-benzyl-2-cyano-4-[[4-(2,4-dimethylphenyl)-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enamide.
| Compound Name | N-benzyl-2-cyano-4-[[4-(2,4-dimethylphenyl)-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enamide |
|---|---|
| PubChem CID | 54725508 |
| Molecular Formula | C33H29N5O2S |
| Molecular Weight | 559.70 g/mol |
| Exact Mass | 559.20 |
| IUPAC Name | N-benzyl-2-cyano-4-[[4-(2,4-dimethylphenyl)-5-(naphthalen-1-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-3-hydroxybut-2-enamide |
| SMILES | Cc1ccc(-n2c(Cc3cccc4ccccc34)nnc2SCC(O)=C(C#N)C(=O)NCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C33H29N5O2S/c1-22-15-16-29(23(2)17-22)38-31(18-26-13-8-12-25-11-6-7-14-27(25)26)36-37-33(38)41-21-30(39)28(19-34)32(40)35-20-24-9-4-3-5-10-24/h3-17,39H,18,20-21H2,1-2H3,(H,35,40) |
| InChIKey | BNPDJDIHTWQAQZ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.70 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|