C14H13NO4S — CID 5472597
4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]benzenesulfonamide (PubChem CID 5472597) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is 4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]benzenesulfonamide.
| Compound Name | 4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 5472597 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 4-[(E)-2-(3,4-dihydroxyphenyl)ethenyl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(/C=C/c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C14H13NO4S/c15-20(18,19)12-6-3-10(4-7-12)1-2-11-5-8-13(16)14(17)9-11/h1-9,16-17H,(H2,15,18,19)/b2-1+ |
| InChIKey | YINNBTDWOUMDGY-OWOJBTEDSA-N |
| XLogP | 1.92 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|