C32H37N5O8 — CID 54726348
(4S,12aR)-9-[[2-(benzylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54726348) has the molecular formula C32H37N5O8 and a molecular weight of 619.68 g/mol. Its IUPAC name is (4S,12aR)-9-[[2-(benzylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-9-[[2-(benzylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54726348 |
| Molecular Formula | C32H37N5O8 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | (4S,12aR)-9-[[2-(benzylamino)acetyl]amino]-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1cc(NC(=O)CNCc2ccccc2)c(O)c2c1CC1CC3[C@H](N(C)C)C(=O)C(C(N)=O)=C(O)[C@@]3(O)C(=O)C1=C2O |
| InChI | InChI=1S/C32H37N5O8/c1-36(2)20-12-19(35-21(38)14-34-13-15-8-6-5-7-9-15)26(39)23-17(20)10-16-11-18-25(37(3)4)28(41)24(31(33)44)30(43)32(18,45)29(42)22(16)27(23)40/h5-9,12,16,18,25,34,39-40,43,45H,10-11,13-14H2,1-4H3,(H2,33,44)(H,35,38)/t16?,18?,25-,32-/m0/s1 |
| InChIKey | ZLXLTUCXNOYTGM-SRFGFSLGSA-N |
| XLogP | 0.76 |
| TPSA | 205.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|