C31H43N5O8 — CID 54726358
(4S,12aR)-4,7-bis(dimethylamino)-9-[[2-(hexylamino)acetyl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54726358) has the molecular formula C31H43N5O8 and a molecular weight of 613.71 g/mol. Its IUPAC name is (4S,12aR)-4,7-bis(dimethylamino)-9-[[2-(hexylamino)acetyl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4,7-bis(dimethylamino)-9-[[2-(hexylamino)acetyl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54726358 |
| Molecular Formula | C31H43N5O8 |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.31 |
| IUPAC Name | (4S,12aR)-4,7-bis(dimethylamino)-9-[[2-(hexylamino)acetyl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CCCCCCNCC(=O)Nc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3CC1C2 |
| InChI | InChI=1S/C31H43N5O8/c1-6-7-8-9-10-33-14-20(37)34-18-13-19(35(2)3)16-11-15-12-17-24(36(4)5)27(40)23(30(32)43)29(42)31(17,44)28(41)21(15)26(39)22(16)25(18)38/h13,15,17,24,33,38-39,42,44H,6-12,14H2,1-5H3,(H2,32,43)(H,34,37)/t15?,17?,24-,31-/m0/s1 |
| InChIKey | ZNVPZNZJTCASRQ-JLDRQUDXSA-N |
| XLogP | 1.14 |
| TPSA | 205.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|