C26H33N5O8 — CID 54726362
(4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[2-(methylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54726362) has the molecular formula C26H33N5O8 and a molecular weight of 543.58 g/mol. Its IUPAC name is (4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[2-(methylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[2-(methylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54726362 |
| Molecular Formula | C26H33N5O8 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | (4S,12aR)-4,7-bis(dimethylamino)-1,10,11,12a-tetrahydroxy-9-[[2-(methylamino)acetyl]amino]-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CNCC(=O)Nc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3CC1C2 |
| InChI | InChI=1S/C26H33N5O8/c1-28-9-15(32)29-13-8-14(30(2)3)11-6-10-7-12-19(31(4)5)22(35)18(25(27)38)24(37)26(12,39)23(36)16(10)21(34)17(11)20(13)33/h8,10,12,19,28,33-34,37,39H,6-7,9H2,1-5H3,(H2,27,38)(H,29,32)/t10?,12?,19-,26-/m0/s1 |
| InChIKey | SNRJGJWRLROQHB-GHHGHXDWSA-N |
| XLogP | -0.81 |
| TPSA | 205.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|