C24H26N3+ — CID 5472654
N,N-dimethyl-4-[(Z)-(6-methyl-7,8,9,10-tetrahydroindolo[1,2-b]indazol-6-ium-11-ylidene)methyl]aniline (PubChem CID 5472654) has the molecular formula C24H26N3+ and a molecular weight of 356.49 g/mol. Its IUPAC name is N,N-dimethyl-4-[(Z)-(6-methyl-7,8,9,10-tetrahydroindolo[1,2-b]indazol-6-ium-11-ylidene)methyl]aniline.
| Compound Name | N,N-dimethyl-4-[(Z)-(6-methyl-7,8,9,10-tetrahydroindolo[1,2-b]indazol-6-ium-11-ylidene)methyl]aniline |
|---|---|
| PubChem CID | 5472654 |
| Molecular Formula | C24H26N3+ |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N,N-dimethyl-4-[(Z)-(6-methyl-7,8,9,10-tetrahydroindolo[1,2-b]indazol-6-ium-11-ylidene)methyl]aniline |
| SMILES | CN(C)c1ccc(/C=c2/c3ccccc3n3c2c2c([n+]3C)CCCC2)cc1 |
| InChI | InChI=1S/C24H26N3/c1-25(2)18-14-12-17(13-15-18)16-21-19-8-4-7-11-23(19)27-24(21)20-9-5-6-10-22(20)26(27)3/h4,7-8,11-16H,5-6,9-10H2,1-3H3/q+1 |
| InChIKey | OZJIIJJBIWSVOR-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 11.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|