C19H16N2O6 — CID 54726650
1-[2-(4-hydroxy-3,5-dimethyl-6-oxopyran-2-yl)-1-benzofuran-5-yl]piperazine-2,3-dione (PubChem CID 54726650) has the molecular formula C19H16N2O6 and a molecular weight of 368.35 g/mol. Its IUPAC name is 1-[2-(4-hydroxy-3,5-dimethyl-6-oxopyran-2-yl)-1-benzofuran-5-yl]piperazine-2,3-dione.
| Compound Name | 1-[2-(4-hydroxy-3,5-dimethyl-6-oxopyran-2-yl)-1-benzofuran-5-yl]piperazine-2,3-dione |
|---|---|
| PubChem CID | 54726650 |
| Molecular Formula | C19H16N2O6 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | 1-[2-(4-hydroxy-3,5-dimethyl-6-oxopyran-2-yl)-1-benzofuran-5-yl]piperazine-2,3-dione |
| SMILES | Cc1c(-c2cc3cc(N4CCNC(=O)C4=O)ccc3o2)oc(=O)c(C)c1O |
| InChI | InChI=1S/C19H16N2O6/c1-9-15(22)10(2)19(25)27-16(9)14-8-11-7-12(3-4-13(11)26-14)21-6-5-20-17(23)18(21)24/h3-4,7-8,22H,5-6H2,1-2H3,(H,20,23) |
| InChIKey | IJTGHJBXBXHQNI-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 112.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|