C24H36O6 — CID 54727407
[(9E,12E,15E)-octadeca-9,12,15-trienyl] (2R)-3-hydroxy-2-(hydroxymethyl)-5-oxo-2H-furan-4-carboxylate (PubChem CID 54727407) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is [(9E,12E,15E)-octadeca-9,12,15-trienyl] (2R)-3-hydroxy-2-(hydroxymethyl)-5-oxo-2H-furan-4-carboxylate.
| Compound Name | [(9E,12E,15E)-octadeca-9,12,15-trienyl] (2R)-3-hydroxy-2-(hydroxymethyl)-5-oxo-2H-furan-4-carboxylate |
|---|---|
| PubChem CID | 54727407 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(9E,12E,15E)-octadeca-9,12,15-trienyl] (2R)-3-hydroxy-2-(hydroxymethyl)-5-oxo-2H-furan-4-carboxylate |
| SMILES | CC/C=C/C/C=C/C/C=C/CCCCCCCCOC(=O)C1=C(O)[C@@H](CO)OC1=O |
| InChI | InChI=1S/C24H36O6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-29-23(27)21-22(26)20(19-25)30-24(21)28/h3-4,6-7,9-10,20,25-26H,2,5,8,11-19H2,1H3/b4-3+,7-6+,10-9+/t20-/m1/s1 |
| InChIKey | DEXVCYYEANEPCW-HGLTYHETSA-N |
| XLogP | 4.85 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|