C23H27N3O12S — CID 54727779
(4S,12aR)-9-acetamido-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid (PubChem CID 54727779) has the molecular formula C23H27N3O12S and a molecular weight of 569.55 g/mol. Its IUPAC name is (4S,12aR)-9-acetamido-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid.
| Compound Name | (4S,12aR)-9-acetamido-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
|---|---|
| PubChem CID | 54727779 |
| Molecular Formula | C23H27N3O12S |
| Molecular Weight | 569.55 g/mol |
| Exact Mass | 569.13 |
| IUPAC Name | (4S,12aR)-9-acetamido-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide;sulfuric acid |
| SMILES | CC(=O)Nc1ccc2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3CC1C2.O=S(=O)(O)O |
| InChI | InChI=1S/C23H25N3O8.H2O4S/c1-8(27)25-12-5-4-9-6-10-7-11-16(26(2)3)19(30)15(22(24)33)21(32)23(11,34)20(31)14(10)18(29)13(9)17(12)28;1-5(2,3)4/h4-5,10-11,16,28-29,32,34H,6-7H2,1-3H3,(H2,24,33)(H,25,27);(H2,1,2,3,4)/t10?,11?,16-,23-;/m0./s1 |
| InChIKey | JOUPCQJFIKBWIJ-ZXZJPVAGSA-N |
| XLogP | -0.73 |
| TPSA | 265.09 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.55 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|