About 1-hydroxy-1,6-dioxonona-2,4-dien-2-olate
1-hydroxy-1,6-dioxonona-2,4-dien-2-olate (PubChem CID 54727805) has the molecular formula C9H11O4-
and a molecular weight of 183.18 g/mol. Its IUPAC name is 1-hydroxy-1,6-dioxonona-2,4-dien-2-olate.
Molecular Properties
| Compound Name | 1-hydroxy-1,6-dioxonona-2,4-dien-2-olate |
| PubChem CID | 54727805 |
| Molecular Formula | C9H11O4- |
| Molecular Weight | 183.18 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 1-hydroxy-1,6-dioxonona-2,4-dien-2-olate |
| SMILES | CCCC(=O)C=CC=C([O-])C(=O)O |
| InChI | InChI=1S/C9H12O4/c1-2-4-7(10)5-3-6-8(11)9(12)13/h3,5-6,11H,2,4H2,1H3,(H,12,13)/p-1 |
| InChIKey | XUNCLPUITPERRV-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.18 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxy-1,6-dioxonona-2,4-dien-2-olate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-1,6-dioxonona-2,4-dien-2-olate?
The IUPAC name of 1-hydroxy-1,6-dioxonona-2,4-dien-2-olate (CID 54727805) is 1-hydroxy-1,6-dioxonona-2,4-dien-2-olate.
What is the SMILES notation for 1-hydroxy-1,6-dioxonona-2,4-dien-2-olate?
The canonical SMILES for 1-hydroxy-1,6-dioxonona-2,4-dien-2-olate is CCCC(=O)C=CC=C([O-])C(=O)O.
What is the InChIKey of 1-hydroxy-1,6-dioxonona-2,4-dien-2-olate?
The InChIKey is XUNCLPUITPERRV-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H12O4/c1-2-4-7(10)5-3-6-8(11)9(12)13/h3,5-6,11H,2,4H2,1H3,(H,12,13)/p-1.
What are the key properties of 1-hydroxy-1,6-dioxonona-2,4-dien-2-olate?
1-hydroxy-1,6-dioxonona-2,4-dien-2-olate has a molecular weight of 183.18 g/mol, XLogP of 0.24, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-1,6-dioxonona-2,4-dien-2-olate is sourced from PubChem (CID 54727805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).