C14H5F6N3O4S — CID 54728141
7-fluoro-4-hydroxy-2-oxo-N-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide (PubChem CID 54728141) has the molecular formula C14H5F6N3O4S and a molecular weight of 425.27 g/mol. Its IUPAC name is 7-fluoro-4-hydroxy-2-oxo-N-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide.
| Compound Name | 7-fluoro-4-hydroxy-2-oxo-N-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 54728141 |
| Molecular Formula | C14H5F6N3O4S |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | 7-fluoro-4-hydroxy-2-oxo-N-[5-(1,1,2,2,2-pentafluoroethyl)-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide |
| SMILES | O=C(Nc1nnc(C(F)(F)C(F)(F)F)s1)c1c(O)c2ccc(F)cc2oc1=O |
| InChI | InChI=1S/C14H5F6N3O4S/c15-4-1-2-5-6(3-4)27-10(26)7(8(5)24)9(25)21-12-23-22-11(28-12)13(16,17)14(18,19)20/h1-3,24H,(H,21,23,25) |
| InChIKey | QPXQIPPYPDKBDR-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|