About bis(2-carboxy-4,6-diiodophenolate);manganese(2+)
bis(2-carboxy-4,6-diiodophenolate);manganese(2+) (PubChem CID 54728317) has the molecular formula C14H6I4MnO6
and a molecular weight of 832.75 g/mol. Its IUPAC name is bis(2-carboxy-4,6-diiodophenolate);manganese(2+).
Molecular Properties
| Compound Name | bis(2-carboxy-4,6-diiodophenolate);manganese(2+) |
| PubChem CID | 54728317 |
| Molecular Formula | C14H6I4MnO6 |
| Molecular Weight | 832.75 g/mol |
| Exact Mass | 832.57 |
| IUPAC Name | bis(2-carboxy-4,6-diiodophenolate);manganese(2+) |
| SMILES | O=C(O)c1cc(I)cc(I)c1[O-].O=C(O)c1cc(I)cc(I)c1[O-].[Mn+2] |
| InChI | InChI=1S/2C7H4I2O3.Mn/c2*8-3-1-4(7(11)12)6(10)5(9)2-3;/h2*1-2,10H,(H,11,12);/q;;+2/p-2 |
| InChIKey | XCXVDWIXRGHXQR-UHFFFAOYSA-L |
| XLogP | 3.33 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 832.75 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bis(2-carboxy-4,6-diiodophenolate);manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-carboxy-4,6-diiodophenolate);manganese(2+)?
The IUPAC name of bis(2-carboxy-4,6-diiodophenolate);manganese(2+) (CID 54728317) is bis(2-carboxy-4,6-diiodophenolate);manganese(2+).
What is the SMILES notation for bis(2-carboxy-4,6-diiodophenolate);manganese(2+)?
The canonical SMILES for bis(2-carboxy-4,6-diiodophenolate);manganese(2+) is O=C(O)c1cc(I)cc(I)c1[O-].O=C(O)c1cc(I)cc(I)c1[O-].[Mn+2].
What is the InChIKey of bis(2-carboxy-4,6-diiodophenolate);manganese(2+)?
The InChIKey is XCXVDWIXRGHXQR-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H4I2O3.Mn/c2*8-3-1-4(7(11)12)6(10)5(9)2-3;/h2*1-2,10H,(H,11,12);/q;;+2/p-2.
What are the key properties of bis(2-carboxy-4,6-diiodophenolate);manganese(2+)?
bis(2-carboxy-4,6-diiodophenolate);manganese(2+) has a molecular weight of 832.75 g/mol, XLogP of 3.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-carboxy-4,6-diiodophenolate);manganese(2+) is sourced from PubChem (CID 54728317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).