C20H32O2 — CID 5472850
(1R,4E,8E,12S,14R)-1,5,9-trimethyl-12-(2-methyloxiran-2-yl)-15-oxabicyclo[12.1.0]pentadeca-4,8-diene (PubChem CID 5472850) has the molecular formula C20H32O2 and a molecular weight of 304.47 g/mol. Its IUPAC name is (1R,4E,8E,12S,14R)-1,5,9-trimethyl-12-(2-methyloxiran-2-yl)-15-oxabicyclo[12.1.0]pentadeca-4,8-diene.
| Compound Name | (1R,4E,8E,12S,14R)-1,5,9-trimethyl-12-(2-methyloxiran-2-yl)-15-oxabicyclo[12.1.0]pentadeca-4,8-diene |
|---|---|
| PubChem CID | 5472850 |
| Molecular Formula | C20H32O2 |
| Molecular Weight | 304.47 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | (1R,4E,8E,12S,14R)-1,5,9-trimethyl-12-(2-methyloxiran-2-yl)-15-oxabicyclo[12.1.0]pentadeca-4,8-diene |
| SMILES | C/C1=C\CC[C@@]2(C)O[C@@H]2C[C@@H](C2(C)CO2)CC/C(C)=C/CC1 |
| InChI | InChI=1S/C20H32O2/c1-15-7-5-8-16(2)10-11-17(20(4)14-21-20)13-18-19(3,22-18)12-6-9-15/h8-9,17-18H,5-7,10-14H2,1-4H3/b15-9+,16-8+/t17-,18+,19+,20?/m0/s1 |
| InChIKey | MIEWOGXTDVXGTN-TVFDWPSESA-N |
| XLogP | 5.19 |
| TPSA | 25.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.47 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|