C32H37N5O8 — CID 54728614
(4S,12aR)-4,7-bis(dimethylamino)-9-[[4-(dimethylamino)benzoyl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54728614) has the molecular formula C32H37N5O8 and a molecular weight of 619.68 g/mol. Its IUPAC name is (4S,12aR)-4,7-bis(dimethylamino)-9-[[4-(dimethylamino)benzoyl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4,7-bis(dimethylamino)-9-[[4-(dimethylamino)benzoyl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54728614 |
| Molecular Formula | C32H37N5O8 |
| Molecular Weight | 619.68 g/mol |
| Exact Mass | 619.26 |
| IUPAC Name | (4S,12aR)-4,7-bis(dimethylamino)-9-[[4-(dimethylamino)benzoyl]amino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)c1ccc(C(=O)Nc2cc(N(C)C)c3c(c2O)C(O)=C2C(=O)[C@]4(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C4CC2C3)cc1 |
| InChI | InChI=1S/C32H37N5O8/c1-35(2)16-9-7-14(8-10-16)31(44)34-19-13-20(36(3)4)17-11-15-12-18-24(37(5)6)27(40)23(30(33)43)29(42)32(18,45)28(41)21(15)26(39)22(17)25(19)38/h7-10,13,15,18,24,38-39,42,45H,11-12H2,1-6H3,(H2,33,43)(H,34,44)/t15?,18?,24-,32-/m0/s1 |
| InChIKey | OHUXOKLORSENHT-CTSGYULQSA-N |
| XLogP | 1.35 |
| TPSA | 196.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.68 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|