C29H39N5O8 — CID 54728615
(4S,12aR)-4,7-bis(dimethylamino)-9-[4-(dimethylamino)butanoylamino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide (PubChem CID 54728615) has the molecular formula C29H39N5O8 and a molecular weight of 585.66 g/mol. Its IUPAC name is (4S,12aR)-4,7-bis(dimethylamino)-9-[4-(dimethylamino)butanoylamino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide.
| Compound Name | (4S,12aR)-4,7-bis(dimethylamino)-9-[4-(dimethylamino)butanoylamino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
|---|---|
| PubChem CID | 54728615 |
| Molecular Formula | C29H39N5O8 |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.28 |
| IUPAC Name | (4S,12aR)-4,7-bis(dimethylamino)-9-[4-(dimethylamino)butanoylamino]-1,10,11,12a-tetrahydroxy-3,12-dioxo-4a,5,5a,6-tetrahydro-4H-tetracene-2-carboxamide |
| SMILES | CN(C)CCCC(=O)Nc1cc(N(C)C)c2c(c1O)C(O)=C1C(=O)[C@]3(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)C3CC1C2 |
| InChI | InChI=1S/C29H39N5O8/c1-32(2)9-7-8-18(35)31-16-12-17(33(3)4)14-10-13-11-15-22(34(5)6)25(38)21(28(30)41)27(40)29(15,42)26(39)19(13)24(37)20(14)23(16)36/h12-13,15,22,36-37,40,42H,7-11H2,1-6H3,(H2,30,41)(H,31,35)/t13?,15?,22-,29-/m0/s1 |
| InChIKey | PPEFKZLNQIWZCX-MELQAVIYSA-N |
| XLogP | 0.31 |
| TPSA | 196.97 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|