About methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate
methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate (PubChem CID 54728677) has the molecular formula C8H8O3S2
and a molecular weight of 216.28 g/mol. Its IUPAC name is methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate |
| PubChem CID | 54728677 |
| Molecular Formula | C8H8O3S2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2c(c1O)CSC2 |
| InChI | InChI=1S/C8H8O3S2/c1-11-8(10)7-6(9)4-2-12-3-5(4)13-7/h9H,2-3H2,1H3 |
| InChIKey | GZPMADSAACMFNA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate?
The IUPAC name of methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate (CID 54728677) is methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate.
What is the SMILES notation for methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate?
The canonical SMILES for methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate is COC(=O)c1sc2c(c1O)CSC2.
What is the InChIKey of methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate?
The InChIKey is GZPMADSAACMFNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8O3S2/c1-11-8(10)7-6(9)4-2-12-3-5(4)13-7/h9H,2-3H2,1H3.
What are the key properties of methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate?
methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate has a molecular weight of 216.28 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-hydroxy-4,6-dihydrothieno[3,4-b]thiophene-2-carboxylate is sourced from PubChem (CID 54728677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).