C18H16ClNO3 — CID 54728748
6-[(1E,3E,5E,7E)-8-(3-chloro-1H-pyrrol-2-yl)octa-1,3,5,7-tetraenyl]-4-hydroxy-3-methylpyran-2-one (PubChem CID 54728748) has the molecular formula C18H16ClNO3 and a molecular weight of 329.78 g/mol. Its IUPAC name is 6-[(1E,3E,5E,7E)-8-(3-chloro-1H-pyrrol-2-yl)octa-1,3,5,7-tetraenyl]-4-hydroxy-3-methylpyran-2-one.
| Compound Name | 6-[(1E,3E,5E,7E)-8-(3-chloro-1H-pyrrol-2-yl)octa-1,3,5,7-tetraenyl]-4-hydroxy-3-methylpyran-2-one |
|---|---|
| PubChem CID | 54728748 |
| Molecular Formula | C18H16ClNO3 |
| Molecular Weight | 329.78 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 6-[(1E,3E,5E,7E)-8-(3-chloro-1H-pyrrol-2-yl)octa-1,3,5,7-tetraenyl]-4-hydroxy-3-methylpyran-2-one |
| SMILES | Cc1c(O)cc(/C=C/C=C/C=C/C=C/c2[nH]ccc2Cl)oc1=O |
| InChI | InChI=1S/C18H16ClNO3/c1-13-17(21)12-14(23-18(13)22)8-6-4-2-3-5-7-9-16-15(19)10-11-20-16/h2-12,20-21H,1H3/b4-2+,5-3+,8-6+,9-7+ |
| InChIKey | XUQWAQPDNWJZBS-VTXBTNDESA-N |
| XLogP | 4.47 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.78 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|