C24H38IN3O3 — CID 54728781
triethyl-[2-[(1-hexyl-4-hydroxy-2-oxoquinoline-3-carbonyl)amino]ethyl]azanium iodide (PubChem CID 54728781) has the molecular formula C24H38IN3O3 and a molecular weight of 543.49 g/mol. Its IUPAC name is triethyl-[2-[(1-hexyl-4-hydroxy-2-oxoquinoline-3-carbonyl)amino]ethyl]azanium iodide.
| Compound Name | triethyl-[2-[(1-hexyl-4-hydroxy-2-oxoquinoline-3-carbonyl)amino]ethyl]azanium iodide |
|---|---|
| PubChem CID | 54728781 |
| Molecular Formula | C24H38IN3O3 |
| Molecular Weight | 543.49 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | triethyl-[2-[(1-hexyl-4-hydroxy-2-oxoquinoline-3-carbonyl)amino]ethyl]azanium iodide |
| SMILES | CCCCCCn1c(=O)c(C(=O)NCC[N+](CC)(CC)CC)c(O)c2ccccc21.[I-] |
| InChI | InChI=1S/C24H37N3O3.HI/c1-5-9-10-13-17-26-20-15-12-11-14-19(20)22(28)21(24(26)30)23(29)25-16-18-27(6-2,7-3)8-4;/h11-12,14-15H,5-10,13,16-18H2,1-4H3,(H-,25,28,29,30);1H |
| InChIKey | YSKHHYOKPBDECT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.49 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|