C31H28N2O7 — CID 54728956
(4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-phenyl-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 54728956) has the molecular formula C31H28N2O7 and a molecular weight of 540.57 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-phenyl-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-phenyl-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 54728956 |
| Molecular Formula | C31H28N2O7 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-3,14-dioxo-10-phenyl-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(cc5ccc(-c6ccccc6)cc5c4O)C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C31H28N2O7/c1-33(2)24-20-13-18-11-17-10-16-9-8-15(14-6-4-3-5-7-14)12-19(16)25(34)21(17)26(35)22(18)28(37)31(20,40)29(38)23(27(24)36)30(32)39/h3-10,12,18,20,24,34-35,38,40H,11,13H2,1-2H3,(H2,32,39)/t18-,20-,24-,31-/m0/s1 |
| InChIKey | FOUHPRDKYHBRND-YSZMQTSISA-N |
| XLogP | 2.78 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|