C33H33N3O7 — CID 54728959
(4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-10-[(N-methylanilino)methyl]-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 54728959) has the molecular formula C33H33N3O7 and a molecular weight of 583.64 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-10-[(N-methylanilino)methyl]-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-10-[(N-methylanilino)methyl]-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 54728959 |
| Molecular Formula | C33H33N3O7 |
| Molecular Weight | 583.64 g/mol |
| Exact Mass | 583.23 |
| IUPAC Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-1,12,13,14a-tetrahydroxy-10-[(N-methylanilino)methyl]-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | CN(Cc1ccc2cc3c(c(O)c2c1)C(O)=C1C(=O)[C@]2(O)C(O)=C(C(N)=O)C(=O)[C@@H](N(C)C)[C@@H]2C[C@@H]1C3)c1ccccc1 |
| InChI | InChI=1S/C33H33N3O7/c1-35(2)26-22-14-19-13-18-12-17-10-9-16(15-36(3)20-7-5-4-6-8-20)11-21(17)27(37)23(18)28(38)24(19)30(40)33(22,43)31(41)25(29(26)39)32(34)42/h4-12,19,22,26,37-38,41,43H,13-15H2,1-3H3,(H2,34,42)/t19-,22-,26-,33-/m0/s1 |
| InChIKey | WZCRGCMQYHYGOW-UOSGFGQCSA-N |
| XLogP | 2.75 |
| TPSA | 164.63 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|