C22H29NO4 — CID 54729473
3-[(2R,3R,5S,6R)-6-[(2R)-butan-2-yl]-3,5-dimethyloxan-2-yl]-1,4-dihydroxy-5-phenylpyridin-2-one (PubChem CID 54729473) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is 3-[(2R,3R,5S,6R)-6-[(2R)-butan-2-yl]-3,5-dimethyloxan-2-yl]-1,4-dihydroxy-5-phenylpyridin-2-one.
| Compound Name | 3-[(2R,3R,5S,6R)-6-[(2R)-butan-2-yl]-3,5-dimethyloxan-2-yl]-1,4-dihydroxy-5-phenylpyridin-2-one |
|---|---|
| PubChem CID | 54729473 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 3-[(2R,3R,5S,6R)-6-[(2R)-butan-2-yl]-3,5-dimethyloxan-2-yl]-1,4-dihydroxy-5-phenylpyridin-2-one |
| SMILES | CC[C@@H](C)[C@H]1O[C@@H](c2c(O)c(-c3ccccc3)cn(O)c2=O)[C@H](C)C[C@@H]1C |
| InChI | InChI=1S/C22H29NO4/c1-5-13(2)20-14(3)11-15(4)21(27-20)18-19(24)17(12-23(26)22(18)25)16-9-7-6-8-10-16/h6-10,12-15,20-21,24,26H,5,11H2,1-4H3/t13-,14+,15-,20-,21-/m1/s1 |
| InChIKey | KMGDCJDRYJVZCA-JQGYYDNOSA-N |
| XLogP | 4.61 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|