About 4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one
4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one (PubChem CID 54729531) has the molecular formula C19H13NO2S
and a molecular weight of 319.39 g/mol. Its IUPAC name is 4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one.
Molecular Properties
| Compound Name | 4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one |
| PubChem CID | 54729531 |
| Molecular Formula | C19H13NO2S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one |
| SMILES | O=c1[nH]c2scc(-c3ccccc3)c2c(O)c1-c1ccccc1 |
| InChI | InChI=1S/C19H13NO2S/c21-17-15(13-9-5-2-6-10-13)18(22)20-19-16(17)14(11-23-19)12-7-3-1-4-8-12/h1-11H,(H2,20,21,22) |
| InChIKey | CWMHWFSLRVRKRS-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one?
The IUPAC name of 4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one (CID 54729531) is 4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one.
What is the SMILES notation for 4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one?
The canonical SMILES for 4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one is O=c1[nH]c2scc(-c3ccccc3)c2c(O)c1-c1ccccc1.
What is the InChIKey of 4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one?
The InChIKey is CWMHWFSLRVRKRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13NO2S/c21-17-15(13-9-5-2-6-10-13)18(22)20-19-16(17)14(11-23-19)12-7-3-1-4-8-12/h1-11H,(H2,20,21,22).
What are the key properties of 4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one?
4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one has a molecular weight of 319.39 g/mol, XLogP of 4.63, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3,5-diphenyl-7H-thieno[2,3-b]pyridin-6-one is sourced from PubChem (CID 54729531), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).