C11H7Cl2NO4 — CID 54729564
methyl 7,9-dichloro-8-hydroxy-6-oxoquinolizine-3-carboxylate (PubChem CID 54729564) has the molecular formula C11H7Cl2NO4 and a molecular weight of 288.09 g/mol. Its IUPAC name is methyl 7,9-dichloro-8-hydroxy-6-oxoquinolizine-3-carboxylate.
| Compound Name | methyl 7,9-dichloro-8-hydroxy-6-oxoquinolizine-3-carboxylate |
|---|---|
| PubChem CID | 54729564 |
| Molecular Formula | C11H7Cl2NO4 |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | methyl 7,9-dichloro-8-hydroxy-6-oxoquinolizine-3-carboxylate |
| SMILES | COC(=O)c1ccc2c(Cl)c(O)c(Cl)c(=O)n2c1 |
| InChI | InChI=1S/C11H7Cl2NO4/c1-18-11(17)5-2-3-6-7(12)9(15)8(13)10(16)14(6)4-5/h2-4,15H,1H3 |
| InChIKey | JVPYWPXOEKQOSH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |