About 6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid
6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid (PubChem CID 54729639) has the molecular formula C14H14O5S
and a molecular weight of 294.33 g/mol. Its IUPAC name is 6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid.
Molecular Properties
| Compound Name | 6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid |
| PubChem CID | 54729639 |
| Molecular Formula | C14H14O5S |
| Molecular Weight | 294.33 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid |
| SMILES | CCOC(=O)C(=CC=C(O)C(=O)O)Sc1ccccc1 |
| InChI | InChI=1S/C14H14O5S/c1-2-19-14(18)12(9-8-11(15)13(16)17)20-10-6-4-3-5-7-10/h3-9,15H,2H2,1H3,(H,16,17) |
| InChIKey | KOMOKAYHEXNUOG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid?
The IUPAC name of 6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid (CID 54729639) is 6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid.
What is the SMILES notation for 6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid?
The canonical SMILES for 6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid is CCOC(=O)C(=CC=C(O)C(=O)O)Sc1ccccc1.
What is the InChIKey of 6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid?
The InChIKey is KOMOKAYHEXNUOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O5S/c1-2-19-14(18)12(9-8-11(15)13(16)17)20-10-6-4-3-5-7-10/h3-9,15H,2H2,1H3,(H,16,17).
What are the key properties of 6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid?
6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid has a molecular weight of 294.33 g/mol, XLogP of 2.75, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethoxy-2-hydroxy-6-oxo-5-phenylsulfanylhexa-2,4-dienoic acid is sourced from PubChem (CID 54729639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).