About 4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one
4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one (PubChem CID 54730049) has the molecular formula C30H24O4
and a molecular weight of 448.52 g/mol. Its IUPAC name is 4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one.
Molecular Properties
| Compound Name | 4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one |
| PubChem CID | 54730049 |
| Molecular Formula | C30H24O4 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.17 |
| IUPAC Name | 4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one |
| SMILES | O=c1oc2ccccc2c(O)c1[C@@H](C[C@@H](O)c1ccc(-c2ccccc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H24O4/c31-26(23-17-15-21(16-18-23)20-9-3-1-4-10-20)19-25(22-11-5-2-6-12-22)28-29(32)24-13-7-8-14-27(24)34-30(28)33/h1-18,25-26,31-32H,19H2/t25-,26+/m0/s1 |
| InChIKey | SQKNHUGWQQUIBM-IZZNHLLZSA-N |
| XLogP | 6.42 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one?
The IUPAC name of 4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one (CID 54730049) is 4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one.
What is the SMILES notation for 4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one?
The canonical SMILES for 4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one is O=c1oc2ccccc2c(O)c1[C@@H](C[C@@H](O)c1ccc(-c2ccccc2)cc1)c1ccccc1.
What is the InChIKey of 4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one?
The InChIKey is SQKNHUGWQQUIBM-IZZNHLLZSA-N. The full InChI is InChI=1S/C30H24O4/c31-26(23-17-15-21(16-18-23)20-9-3-1-4-10-20)19-25(22-11-5-2-6-12-22)28-29(32)24-13-7-8-14-27(24)34-30(28)33/h1-18,25-26,31-32H,19H2/t25-,26+/m0/s1.
What are the key properties of 4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one?
4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one has a molecular weight of 448.52 g/mol, XLogP of 6.42, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3-[(1S,3R)-3-hydroxy-1-phenyl-3-(4-phenylphenyl)propyl]chromen-2-one is sourced from PubChem (CID 54730049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).