C14H8F3N3O4S — CID 54730070
4-hydroxy-7-methyl-2-oxo-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide (PubChem CID 54730070) has the molecular formula C14H8F3N3O4S and a molecular weight of 371.30 g/mol. Its IUPAC name is 4-hydroxy-7-methyl-2-oxo-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide.
| Compound Name | 4-hydroxy-7-methyl-2-oxo-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 54730070 |
| Molecular Formula | C14H8F3N3O4S |
| Molecular Weight | 371.30 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 4-hydroxy-7-methyl-2-oxo-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]chromene-3-carboxamide |
| SMILES | Cc1ccc2c(O)c(C(=O)Nc3nnc(C(F)(F)F)s3)c(=O)oc2c1 |
| InChI | InChI=1S/C14H8F3N3O4S/c1-5-2-3-6-7(4-5)24-11(23)8(9(6)21)10(22)18-13-20-19-12(25-13)14(15,16)17/h2-4,21H,1H3,(H,18,20,22) |
| InChIKey | WEFDTAKZBZCVOZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.30 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|