C16H23NO — CID 5473024
(2E,6E)-8-anilino-3,7-dimethylocta-2,6-dien-1-ol (PubChem CID 5473024) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is (2E,6E)-8-anilino-3,7-dimethylocta-2,6-dien-1-ol.
| Compound Name | (2E,6E)-8-anilino-3,7-dimethylocta-2,6-dien-1-ol |
|---|---|
| PubChem CID | 5473024 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | (2E,6E)-8-anilino-3,7-dimethylocta-2,6-dien-1-ol |
| SMILES | C/C(=C\CO)CC/C=C(\C)CNc1ccccc1 |
| InChI | InChI=1S/C16H23NO/c1-14(11-12-18)7-6-8-15(2)13-17-16-9-4-3-5-10-16/h3-5,8-11,17-18H,6-7,12-13H2,1-2H3/b14-11+,15-8+ |
| InChIKey | JVVQYWITFPUEFG-GGQZXFEVSA-N |
| XLogP | 3.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|