C20H23Cl2N3O7 — CID 54730269
(6aR,10S,10aS,11aR)-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide;dihydrochloride (PubChem CID 54730269) has the molecular formula C20H23Cl2N3O7 and a molecular weight of 488.32 g/mol. Its IUPAC name is (6aR,10S,10aS,11aR)-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide;dihydrochloride.
| Compound Name | (6aR,10S,10aS,11aR)-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 54730269 |
| Molecular Formula | C20H23Cl2N3O7 |
| Molecular Weight | 488.32 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | (6aR,10S,10aS,11aR)-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide;dihydrochloride |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cncc4C[C@H]3C[C@@H]12.Cl.Cl |
| InChI | InChI=1S/C20H21N3O7.2ClH/c1-23(2)14-9-4-7-3-8-5-22-6-10(24)11(8)15(25)12(7)17(27)20(9,30)18(28)13(16(14)26)19(21)29;;/h5-7,9,14,24-25,28,30H,3-4H2,1-2H3,(H2,21,29);2*1H/t7-,9-,14-,20-;;/m0../s1 |
| InChIKey | PIGDNGFRFHAQKB-KYPFKLLKSA-N |
| XLogP | 0.20 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.32 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|