C26H27Cl2N3O7 — CID 54730291
(6aR,10S,10aS,11aR)-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-1-phenyl-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide;dihydrochloride (PubChem CID 54730291) has the molecular formula C26H27Cl2N3O7 and a molecular weight of 564.42 g/mol. Its IUPAC name is (6aR,10S,10aS,11aR)-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-1-phenyl-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide;dihydrochloride.
| Compound Name | (6aR,10S,10aS,11aR)-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-1-phenyl-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 54730291 |
| Molecular Formula | C26H27Cl2N3O7 |
| Molecular Weight | 564.42 g/mol |
| Exact Mass | 563.12 |
| IUPAC Name | (6aR,10S,10aS,11aR)-10-(dimethylamino)-4,5,6a,7-tetrahydroxy-6,9-dioxo-1-phenyl-10a,11,11a,12-tetrahydro-10H-naphtho[3,2-g]isoquinoline-8-carboxamide;dihydrochloride |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(O)cnc(-c5ccccc5)c4C[C@H]3C[C@@H]12.Cl.Cl |
| InChI | InChI=1S/C26H25N3O7.2ClH/c1-29(2)20-14-9-12-8-13-17(15(30)10-28-19(13)11-6-4-3-5-7-11)21(31)16(12)23(33)26(14,36)24(34)18(22(20)32)25(27)35;;/h3-7,10,12,14,20,30-31,34,36H,8-9H2,1-2H3,(H2,27,35);2*1H/t12-,14-,20-,26-;;/m0../s1 |
| InChIKey | SJEPCWLLWIXZTC-BYLVEPDZSA-N |
| XLogP | 1.87 |
| TPSA | 174.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|