C10H10N4S2 — CID 5473102
11,13-diamino-8-thia-10,12-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),9,11-tetraene-7-thione (PubChem CID 5473102) has the molecular formula C10H10N4S2 and a molecular weight of 250.35 g/mol. Its IUPAC name is 11,13-diamino-8-thia-10,12-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),9,11-tetraene-7-thione.
| Compound Name | 11,13-diamino-8-thia-10,12-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),9,11-tetraene-7-thione |
|---|---|
| PubChem CID | 5473102 |
| Molecular Formula | C10H10N4S2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.03 |
| IUPAC Name | 11,13-diamino-8-thia-10,12-diazatricyclo[7.4.0.02,6]trideca-1(13),2(6),9,11-tetraene-7-thione |
| SMILES | Nc1nc(N)c2c3c(c(=S)sc2n1)CCC3 |
| InChI | InChI=1S/C10H10N4S2/c11-7-6-4-2-1-3-5(4)9(15)16-8(6)14-10(12)13-7/h1-3H2,(H4,11,12,13,14) |
| InChIKey | JAOOXAYSZGQHJM-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ester_A(5)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|