About ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate
ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate (PubChem CID 54731416) has the molecular formula C11H10N2O4
and a molecular weight of 234.21 g/mol. Its IUPAC name is ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate |
| PubChem CID | 54731416 |
| Molecular Formula | C11H10N2O4 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(O)c2cccnc2[nH]c1=O |
| InChI | InChI=1S/C11H10N2O4/c1-2-17-11(16)7-8(14)6-4-3-5-12-9(6)13-10(7)15/h3-5H,2H2,1H3,(H2,12,13,14,15) |
| InChIKey | HOHNPZFKJNMKDE-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 92.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate?
The IUPAC name of ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate (CID 54731416) is ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate.
What is the SMILES notation for ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate?
The canonical SMILES for ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate is CCOC(=O)c1c(O)c2cccnc2[nH]c1=O.
What is the InChIKey of ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate?
The InChIKey is HOHNPZFKJNMKDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O4/c1-2-17-11(16)7-8(14)6-4-3-5-12-9(6)13-10(7)15/h3-5H,2H2,1H3,(H2,12,13,14,15).
What are the key properties of ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate?
ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate has a molecular weight of 234.21 g/mol, XLogP of 0.81, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-hydroxy-2-oxo-1H-1,8-naphthyridine-3-carboxylate is sourced from PubChem (CID 54731416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).