About 2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid
2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid (PubChem CID 54731591) has the molecular formula C10H9NO7S2
and a molecular weight of 319.32 g/mol. Its IUPAC name is 2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid |
| PubChem CID | 54731591 |
| Molecular Formula | C10H9NO7S2 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid |
| SMILES | COC(=O)C1=C(O)c2sccc2S(=O)(=O)N1CC(=O)O |
| InChI | InChI=1S/C10H9NO7S2/c1-18-10(15)7-8(14)9-5(2-3-19-9)20(16,17)11(7)4-6(12)13/h2-3,14H,4H2,1H3,(H,12,13) |
| InChIKey | ZPNVHAJLXWBFLG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 121.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid?
The IUPAC name of 2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid (CID 54731591) is 2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid.
What is the SMILES notation for 2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid?
The canonical SMILES for 2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid is COC(=O)C1=C(O)c2sccc2S(=O)(=O)N1CC(=O)O.
What is the InChIKey of 2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid?
The InChIKey is ZPNVHAJLXWBFLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO7S2/c1-18-10(15)7-8(14)9-5(2-3-19-9)20(16,17)11(7)4-6(12)13/h2-3,14H,4H2,1H3,(H,12,13).
What are the key properties of 2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid?
2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid has a molecular weight of 319.32 g/mol, XLogP of 0.24, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-hydroxy-3-methoxycarbonyl-1,1-dioxothieno[2,3-e]thiazin-2-yl)acetic acid is sourced from PubChem (CID 54731591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).