About 6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one
6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one (PubChem CID 54732123) has the molecular formula C24H22O5
and a molecular weight of 390.44 g/mol. Its IUPAC name is 6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one.
Molecular Properties
| Compound Name | 6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one |
| PubChem CID | 54732123 |
| Molecular Formula | C24H22O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one |
| SMILES | Cc1cc(C)cc(COc2ccc3oc(-c4oc(=O)c(C)c(O)c4C)cc3c2)c1 |
| InChI | InChI=1S/C24H22O5/c1-13-7-14(2)9-17(8-13)12-27-19-5-6-20-18(10-19)11-21(28-20)23-15(3)22(25)16(4)24(26)29-23/h5-11,25H,12H2,1-4H3 |
| InChIKey | SKKSQUYITHQAPU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one?
The IUPAC name of 6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one (CID 54732123) is 6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one.
What is the SMILES notation for 6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one?
The canonical SMILES for 6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one is Cc1cc(C)cc(COc2ccc3oc(-c4oc(=O)c(C)c(O)c4C)cc3c2)c1.
What is the InChIKey of 6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one?
The InChIKey is SKKSQUYITHQAPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H22O5/c1-13-7-14(2)9-17(8-13)12-27-19-5-6-20-18(10-19)11-21(28-20)23-15(3)22(25)16(4)24(26)29-23/h5-11,25H,12H2,1-4H3.
What are the key properties of 6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one?
6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one has a molecular weight of 390.44 g/mol, XLogP of 5.57, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[5-[(3,5-dimethylphenyl)methoxy]-1-benzofuran-2-yl]-4-hydroxy-3,5-dimethylpyran-2-one is sourced from PubChem (CID 54732123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).