C34H36N2O11 — CID 54732403
[(2R,3R,4R,5R)-4-hydroxy-2-[4-hydroxy-3-[(4-hydroxy-3-prop-2-enylbenzoyl)amino]-8-methyl-2-oxochromen-7-yl]oxy-5-methoxy-6,6-dimethyloxan-3-yl] 5-methyl-1H-pyrrole-2-carboxylate (PubChem CID 54732403) has the molecular formula C34H36N2O11 and a molecular weight of 648.67 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-hydroxy-2-[4-hydroxy-3-[(4-hydroxy-3-prop-2-enylbenzoyl)amino]-8-methyl-2-oxochromen-7-yl]oxy-5-methoxy-6,6-dimethyloxan-3-yl] 5-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | [(2R,3R,4R,5R)-4-hydroxy-2-[4-hydroxy-3-[(4-hydroxy-3-prop-2-enylbenzoyl)amino]-8-methyl-2-oxochromen-7-yl]oxy-5-methoxy-6,6-dimethyloxan-3-yl] 5-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 54732403 |
| Molecular Formula | C34H36N2O11 |
| Molecular Weight | 648.67 g/mol |
| Exact Mass | 648.23 |
| IUPAC Name | [(2R,3R,4R,5R)-4-hydroxy-2-[4-hydroxy-3-[(4-hydroxy-3-prop-2-enylbenzoyl)amino]-8-methyl-2-oxochromen-7-yl]oxy-5-methoxy-6,6-dimethyloxan-3-yl] 5-methyl-1H-pyrrole-2-carboxylate |
| SMILES | C=CCc1cc(C(=O)Nc2c(O)c3ccc(O[C@@H]4OC(C)(C)[C@H](OC)[C@@H](O)[C@H]4OC(=O)c4ccc(C)[nH]4)c(C)c3oc2=O)ccc1O |
| InChI | InChI=1S/C34H36N2O11/c1-7-8-18-15-19(10-13-22(18)37)30(40)36-24-25(38)20-11-14-23(17(3)27(20)45-32(24)42)44-33-28(26(39)29(43-6)34(4,5)47-33)46-31(41)21-12-9-16(2)35-21/h7,9-15,26,28-29,33,35,37-39H,1,8H2,2-6H3,(H,36,40)/t26-,28+,29+,33+/m0/s1 |
| InChIKey | UGFUKEQRKJXIPK-DBPUXHPHSA-N |
| XLogP | 4.25 |
| TPSA | 189.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.67 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|