C32H34N2O11 — CID 54732410
[(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-[(4-hydroxy-3,5-dimethylbenzoyl)amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate (PubChem CID 54732410) has the molecular formula C32H34N2O11 and a molecular weight of 622.63 g/mol. Its IUPAC name is [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-[(4-hydroxy-3,5-dimethylbenzoyl)amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-[(4-hydroxy-3,5-dimethylbenzoyl)amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 54732410 |
| Molecular Formula | C32H34N2O11 |
| Molecular Weight | 622.63 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | [(3R,4S,5R,6R)-5-hydroxy-6-[4-hydroxy-3-[(4-hydroxy-3,5-dimethylbenzoyl)amino]-2-oxochromen-7-yl]oxy-3-methoxy-2,2-dimethyloxan-4-yl] 5-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CO[C@@H]1[C@@H](OC(=O)c2ccc(C)[nH]2)[C@@H](O)[C@H](Oc2ccc3c(O)c(NC(=O)c4cc(C)c(O)c(C)c4)c(=O)oc3c2)OC1(C)C |
| InChI | InChI=1S/C32H34N2O11/c1-14-11-17(12-15(2)23(14)35)28(38)34-22-24(36)19-9-8-18(13-21(19)43-30(22)40)42-31-25(37)26(27(41-6)32(4,5)45-31)44-29(39)20-10-7-16(3)33-20/h7-13,25-27,31,33,35-37H,1-6H3,(H,34,38)/t25-,26+,27-,31-/m1/s1 |
| InChIKey | HCJJVFGHYYFOIL-KUYWTNKVSA-N |
| XLogP | 3.83 |
| TPSA | 189.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.63 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|