About prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate
prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate (PubChem CID 54732863) has the molecular formula C15H15NO6
and a molecular weight of 305.29 g/mol. Its IUPAC name is prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate.
Molecular Properties
| Compound Name | prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate |
| PubChem CID | 54732863 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate |
| SMILES | C=CCOC(=O)c1c(O)c2cc(OC)c(OC)cc2[nH]c1=O |
| InChI | InChI=1S/C15H15NO6/c1-4-5-22-15(19)12-13(17)8-6-10(20-2)11(21-3)7-9(8)16-14(12)18/h4,6-7H,1,5H2,2-3H3,(H2,16,17,18) |
| InChIKey | HNIGIHSYPWOJJQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 97.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate?
The IUPAC name of prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate (CID 54732863) is prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate.
What is the SMILES notation for prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate?
The canonical SMILES for prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate is C=CCOC(=O)c1c(O)c2cc(OC)c(OC)cc2[nH]c1=O.
What is the InChIKey of prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate?
The InChIKey is HNIGIHSYPWOJJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO6/c1-4-5-22-15(19)12-13(17)8-6-10(20-2)11(21-3)7-9(8)16-14(12)18/h4,6-7H,1,5H2,2-3H3,(H2,16,17,18).
What are the key properties of prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate?
prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate has a molecular weight of 305.29 g/mol, XLogP of 1.59, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl 4-hydroxy-6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylate is sourced from PubChem (CID 54732863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).