C23H25FO10 — CID 54733008
tetramethyl (1S,5R,6S,7S,9S)-7-(4-fluorophenyl)-3,5-dihydroxybicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate (PubChem CID 54733008) has the molecular formula C23H25FO10 and a molecular weight of 480.44 g/mol. Its IUPAC name is tetramethyl (1S,5R,6S,7S,9S)-7-(4-fluorophenyl)-3,5-dihydroxybicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate.
| Compound Name | tetramethyl (1S,5R,6S,7S,9S)-7-(4-fluorophenyl)-3,5-dihydroxybicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate |
|---|---|
| PubChem CID | 54733008 |
| Molecular Formula | C23H25FO10 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | tetramethyl (1S,5R,6S,7S,9S)-7-(4-fluorophenyl)-3,5-dihydroxybicyclo[3.3.1]non-2-ene-2,4,6,9-tetracarboxylate |
| SMILES | COC(=O)C1=C(O)C(C(=O)OC)[C@]2(O)[C@@H](C(=O)OC)[C@@H]1C[C@H](c1ccc(F)cc1)[C@@H]2C(=O)OC |
| InChI | InChI=1S/C23H25FO10/c1-31-19(26)14-13-9-12(10-5-7-11(24)8-6-10)15(20(27)32-2)23(30,16(13)21(28)33-3)17(18(14)25)22(29)34-4/h5-8,12-13,15-17,25,30H,9H2,1-4H3/t12-,13-,15-,16-,17?,23-/m1/s1 |
| InChIKey | CJOIBKMLPOXBIQ-DZMOZQEXSA-N |
| XLogP | 1.03 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|