C19H16Cl2N2O3S — CID 54733460
N-(3,5-dichlorophenyl)-4-hydroxy-7-methyl-2-oxo-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-b]pyridine-3-carboxamide (PubChem CID 54733460) has the molecular formula C19H16Cl2N2O3S and a molecular weight of 423.32 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-4-hydroxy-7-methyl-2-oxo-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-b]pyridine-3-carboxamide.
| Compound Name | N-(3,5-dichlorophenyl)-4-hydroxy-7-methyl-2-oxo-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 54733460 |
| Molecular Formula | C19H16Cl2N2O3S |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | N-(3,5-dichlorophenyl)-4-hydroxy-7-methyl-2-oxo-5,6,7,8-tetrahydro-1H-[1]benzothiolo[2,3-b]pyridine-3-carboxamide |
| SMILES | CC1CCc2c(sc3[nH]c(=O)c(C(=O)Nc4cc(Cl)cc(Cl)c4)c(O)c23)C1 |
| InChI | InChI=1S/C19H16Cl2N2O3S/c1-8-2-3-12-13(4-8)27-19-14(12)16(24)15(18(26)23-19)17(25)22-11-6-9(20)5-10(21)7-11/h5-8H,2-4H2,1H3,(H,22,25)(H2,23,24,26) |
| InChIKey | VGHBSYIJQNSGPZ-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |