C25H23FN2O7 — CID 54733792
(4S,4aS,5aR,14aR)-4-(dimethylamino)-10-fluoro-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide (PubChem CID 54733792) has the molecular formula C25H23FN2O7 and a molecular weight of 482.46 g/mol. Its IUPAC name is (4S,4aS,5aR,14aR)-4-(dimethylamino)-10-fluoro-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide.
| Compound Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-10-fluoro-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
|---|---|
| PubChem CID | 54733792 |
| Molecular Formula | C25H23FN2O7 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | (4S,4aS,5aR,14aR)-4-(dimethylamino)-10-fluoro-1,12,13,14a-tetrahydroxy-3,14-dioxo-4a,5,5a,6-tetrahydro-4H-pentacene-2-carboxamide |
| SMILES | CN(C)[C@@H]1C(=O)C(C(N)=O)=C(O)[C@@]2(O)C(=O)C3=C(O)c4c(cc5ccc(F)cc5c4O)C[C@H]3C[C@@H]12 |
| InChI | InChI=1S/C25H23FN2O7/c1-28(2)18-14-7-11-6-10-5-9-3-4-12(26)8-13(9)19(29)15(10)20(30)16(11)22(32)25(14,35)23(33)17(21(18)31)24(27)34/h3-5,8,11,14,18,29-30,33,35H,6-7H2,1-2H3,(H2,27,34)/t11-,14-,18-,25-/m0/s1 |
| InChIKey | GZZNYXJTROWTRJ-NTFWCOLUSA-N |
| XLogP | 1.26 |
| TPSA | 161.39 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|